C29H23IrN2O3- — CID 153444863
(Z)-4-hydroxypent-3-en-2-one;iridium;6-phenyl-4-(3-phenylbenzene-6-id-1-yl)furo[3,2-d]pyrimidine (PubChem CID 153444863) has the molecular formula C29H23IrN2O3- and a molecular weight of 639.73 g/mol. Its IUPAC name is (Z)-4-hydroxypent-3-en-2-one;iridium;6-phenyl-4-(3-phenylbenzene-6-id-1-yl)furo[3,2-d]pyrimidine.
| Compound Name | (Z)-4-hydroxypent-3-en-2-one;iridium;6-phenyl-4-(3-phenylbenzene-6-id-1-yl)furo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 153444863 |
| Molecular Formula | C29H23IrN2O3- |
| Molecular Weight | 639.73 g/mol |
| Exact Mass | 640.13 |
| IUPAC Name | (Z)-4-hydroxypent-3-en-2-one;iridium;6-phenyl-4-(3-phenylbenzene-6-id-1-yl)furo[3,2-d]pyrimidine |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1ccc(-c2ccccc2)cc1-c1ncnc2cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C24H15N2O.C5H8O2.Ir/c1-3-8-17(9-4-1)19-12-7-13-20(14-19)23-24-21(25-16-26-23)15-22(27-24)18-10-5-2-6-11-18;1-4(6)3-5(2)7;/h1-12,14-16H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | MUEBHSNEDNWIBZ-LWFKIUJUSA-N |
| XLogP | 7.06 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|