C6H11BN2O2 — CID 153446075
[2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pyrazol-3-yl]boronic acid (PubChem CID 153446075) has the molecular formula C6H11BN2O2 and a molecular weight of 160.01 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pyrazol-3-yl]boronic acid.
| Compound Name | [2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pyrazol-3-yl]boronic acid |
|---|---|
| PubChem CID | 153446075 |
| Molecular Formula | C6H11BN2O2 |
| Molecular Weight | 160.01 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)pyrazol-3-yl]boronic acid |
| SMILES | [2H]C([2H])([2H])C(n1nccc1B(O)O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H11BN2O2/c1-5(2)9-6(7(10)11)3-4-8-9/h3-5,10-11H,1-2H3/i1D3,2D3 |
| InChIKey | RWQOGZHKBNANKP-WFGJKAKNSA-N |
| XLogP | -0.86 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.01 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|