C5H10BN3O2 — CID 126978964
(2-propan-2-yl-1,2,4-triazol-3-yl)boronic acid (PubChem CID 126978964) has the molecular formula C5H10BN3O2 and a molecular weight of 154.97 g/mol. Its IUPAC name is (2-propan-2-yl-1,2,4-triazol-3-yl)boronic acid.
| Compound Name | (2-propan-2-yl-1,2,4-triazol-3-yl)boronic acid |
|---|---|
| PubChem CID | 126978964 |
| Molecular Formula | C5H10BN3O2 |
| Molecular Weight | 154.97 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2-propan-2-yl-1,2,4-triazol-3-yl)boronic acid |
| SMILES | CC(C)n1ncnc1B(O)O |
| InChI | InChI=1S/C5H10BN3O2/c1-4(2)9-5(6(10)11)7-3-8-9/h3-4,10-11H,1-2H3 |
| InChIKey | MXMMZVIWICVRID-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.97 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|