C18H26BrFN2OSi — CID 153446322
(6-bromo-1-cyclobutyl-4-fluorobenzimidazol-2-yl)methoxy-tert-butyl-dimethylsilane (PubChem CID 153446322) has the molecular formula C18H26BrFN2OSi and a molecular weight of 413.41 g/mol. Its IUPAC name is (6-bromo-1-cyclobutyl-4-fluorobenzimidazol-2-yl)methoxy-tert-butyl-dimethylsilane.
| Compound Name | (6-bromo-1-cyclobutyl-4-fluorobenzimidazol-2-yl)methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 153446322 |
| Molecular Formula | C18H26BrFN2OSi |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (6-bromo-1-cyclobutyl-4-fluorobenzimidazol-2-yl)methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nc2c(F)cc(Br)cc2n1C1CCC1 |
| InChI | InChI=1S/C18H26BrFN2OSi/c1-18(2,3)24(4,5)23-11-16-21-17-14(20)9-12(19)10-15(17)22(16)13-7-6-8-13/h9-10,13H,6-8,11H2,1-5H3 |
| InChIKey | HPZNTHSUFOIKDU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|