C25H36Cl2N6O5Si — CID 153446808
4-chloro-5-[[5-[2-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]oxolan-2-yl]methoxy]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one (PubChem CID 153446808) has the molecular formula C25H36Cl2N6O5Si and a molecular weight of 599.59 g/mol. Its IUPAC name is 4-chloro-5-[[5-[2-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]oxolan-2-yl]methoxy]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[[5-[2-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]oxolan-2-yl]methoxy]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 153446808 |
| Molecular Formula | C25H36Cl2N6O5Si |
| Molecular Weight | 599.59 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | 4-chloro-5-[[5-[2-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-2-oxoethyl]oxolan-2-yl]methoxy]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
| SMILES | C[Si](C)(C)CCOCn1ncc(OCC2CCC(CC(=O)N3CCN(c4ncc(Cl)cn4)CC3)O2)c(Cl)c1=O |
| InChI | InChI=1S/C25H36Cl2N6O5Si/c1-39(2,3)11-10-36-17-33-24(35)23(27)21(15-30-33)37-16-20-5-4-19(38-20)12-22(34)31-6-8-32(9-7-31)25-28-13-18(26)14-29-25/h13-15,19-20H,4-12,16-17H2,1-3H3 |
| InChIKey | IDYVVMFLDMZXNO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 111.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|