C27H37ClN6O5Si — CID 175827606
4-[2-[2-[5-[[5-chloro-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 175827606) has the molecular formula C27H37ClN6O5Si and a molecular weight of 589.17 g/mol. Its IUPAC name is 4-[2-[2-[5-[[5-chloro-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 4-[2-[2-[5-[[5-chloro-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 175827606 |
| Molecular Formula | C27H37ClN6O5Si |
| Molecular Weight | 589.17 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | 4-[2-[2-[5-[[5-chloro-6-oxo-1-(2-trimethylsilylethoxymethyl)pyridazin-4-yl]oxymethyl]oxolan-2-yl]acetyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1ncc(OCC2CCC(CC(=O)C3CNCCN3c3ccncc3C#N)O2)c(Cl)c1=O |
| InChI | InChI=1S/C27H37ClN6O5Si/c1-40(2,3)11-10-37-18-34-27(36)26(28)25(16-32-34)38-17-21-5-4-20(39-21)12-24(35)23-15-31-8-9-33(23)22-6-7-30-14-19(22)13-29/h6-7,14,16,20-21,23,31H,4-5,8-12,15,17-18H2,1-3H3 |
| InChIKey | DLFWOZHNRYNAMY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.17 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|