C26H23ClF2N4O4S2 — CID 153450141
ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[4-(4-formyloxy-1,3-thiazol-2-yl)cyclohexyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 153450141) has the molecular formula C26H23ClF2N4O4S2 and a molecular weight of 593.08 g/mol. Its IUPAC name is ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[4-(4-formyloxy-1,3-thiazol-2-yl)cyclohexyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[4-(4-formyloxy-1,3-thiazol-2-yl)cyclohexyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 153450141 |
| Molecular Formula | C26H23ClF2N4O4S2 |
| Molecular Weight | 593.08 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-[4-(4-formyloxy-1,3-thiazol-2-yl)cyclohexyl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C2CCC(c3nc(OC=O)cs3)CC2)NC(c2nccs2)=NC1c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C26H23ClF2N4O4S2/c1-2-36-26(35)18-21(13-3-5-14(6-4-13)24-31-17(11-39-24)37-12-34)32-23(25-30-9-10-38-25)33-22(18)15-7-8-16(28)20(29)19(15)27/h7-14,22H,2-6H2,1H3,(H,32,33) |
| InChIKey | IJJCYAKZAQZPOJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.08 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|