C17H14ClF2N3O2S — CID 139034625
ethyl 4-(2-chloro-3,4-difluorophenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 139034625) has the molecular formula C17H14ClF2N3O2S and a molecular weight of 397.83 g/mol. Its IUPAC name is ethyl 4-(2-chloro-3,4-difluorophenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 139034625 |
| Molecular Formula | C17H14ClF2N3O2S |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | ethyl 4-(2-chloro-3,4-difluorophenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(c2nccs2)=NC1c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C17H14ClF2N3O2S/c1-3-25-17(24)11-8(2)22-15(16-21-6-7-26-16)23-14(11)9-4-5-10(19)13(20)12(9)18/h4-7,14H,3H2,1-2H3,(H,22,23) |
| InChIKey | IPTMKIDNMNBIRK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|