C19H16ClN3O2S — CID 167180269
ethyl 4-(4-chloro-2-ethynylphenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 167180269) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is ethyl 4-(4-chloro-2-ethynylphenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-chloro-2-ethynylphenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 167180269 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | ethyl 4-(4-chloro-2-ethynylphenyl)-6-methyl-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | C#Cc1cc(Cl)ccc1C1N=C(c2nccs2)NC(C)=C1C(=O)OCC |
| InChI | InChI=1S/C19H16ClN3O2S/c1-4-12-10-13(20)6-7-14(12)16-15(19(24)25-5-2)11(3)22-17(23-16)18-21-8-9-26-18/h1,6-10,16H,5H2,2-3H3,(H,22,23) |
| InChIKey | MDYFQWYUDRZIHB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|