C18H17BFN3O2S — CID 159277065
CID 159277065 (PubChem CID 159277065) has the molecular formula C18H17BFN3O2S and a molecular weight of 369.23 g/mol.
| Compound Name | CID 159277065 |
|---|---|
| PubChem CID | 159277065 |
| Molecular Formula | C18H17BFN3O2S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | — |
| SMILES | [B]CC1=C(C(=O)OCC)[C@H](c2cccc(F)c2C)N=C(c2nccs2)N1 |
| InChI | InChI=1S/C18H17BFN3O2S/c1-3-25-18(24)14-13(9-19)22-16(17-21-7-8-26-17)23-15(14)11-5-4-6-12(20)10(11)2/h4-8,15H,3,9H2,1-2H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | RZLPIKJAAAXWKS-HNNXBMFYSA-N |
| XLogP | 3.09 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|