C17H15Br2N3O2S — CID 140659891
ethyl (4R)-6-(bromomethyl)-4-(2-bromophenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 140659891) has the molecular formula C17H15Br2N3O2S and a molecular weight of 485.20 g/mol. Its IUPAC name is ethyl (4R)-6-(bromomethyl)-4-(2-bromophenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-6-(bromomethyl)-4-(2-bromophenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 140659891 |
| Molecular Formula | C17H15Br2N3O2S |
| Molecular Weight | 485.20 g/mol |
| Exact Mass | 482.93 |
| IUPAC Name | ethyl (4R)-6-(bromomethyl)-4-(2-bromophenyl)-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CBr)NC(c2nccs2)=N[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C17H15Br2N3O2S/c1-2-24-17(23)13-12(9-18)21-15(16-20-7-8-25-16)22-14(13)10-5-3-4-6-11(10)19/h3-8,14H,2,9H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | XZLHBXCQFXIWQB-AWEZNQCLSA-N |
| XLogP | 4.21 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|