C12H17N9O10P2-2 — CID 153452560
[[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-(2-azidoethylamino)phosphinate (PubChem CID 153452560) has the molecular formula C12H17N9O10P2-2 and a molecular weight of 509.27 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-(2-azidoethylamino)phosphinate.
| Compound Name | [[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-(2-azidoethylamino)phosphinate |
|---|---|
| PubChem CID | 153452560 |
| Molecular Formula | C12H17N9O10P2-2 |
| Molecular Weight | 509.27 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | [[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-(2-azidoethylamino)phosphinate |
| SMILES | [N-]=[N+]=NCCNP(=O)([O-])OP(=O)([O-])OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@@H](O)C1O |
| InChI | InChI=1S/C12H19N9O10P2/c13-12-18-9-6(10(24)19-12)15-4-21(9)11-8(23)7(22)5(30-11)3-29-33(27,28)31-32(25,26)17-2-1-16-20-14/h4-5,7-8,11,22-23H,1-3H2,(H,27,28)(H2,17,25,26)(H3,13,18,19,24)/p-2/t5-,7?,8+,11-/m1/s1 |
| InChIKey | GKCJFJBZZRLBEZ-DWVWSIQXSA-L |
| XLogP | -2.81 |
| TPSA | 298.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.27 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|