C16H33N3O2S — CID 153452685
1-tert-butyl-4-(1-tert-butylpyrrolidin-3-yl)sulfonylpiperazine (PubChem CID 153452685) has the molecular formula C16H33N3O2S and a molecular weight of 331.53 g/mol. Its IUPAC name is 1-tert-butyl-4-(1-tert-butylpyrrolidin-3-yl)sulfonylpiperazine.
| Compound Name | 1-tert-butyl-4-(1-tert-butylpyrrolidin-3-yl)sulfonylpiperazine |
|---|---|
| PubChem CID | 153452685 |
| Molecular Formula | C16H33N3O2S |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-tert-butyl-4-(1-tert-butylpyrrolidin-3-yl)sulfonylpiperazine |
| SMILES | CC(C)(C)N1CCN(S(=O)(=O)C2CCN(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C16H33N3O2S/c1-15(2,3)17-9-11-19(12-10-17)22(20,21)14-7-8-18(13-14)16(4,5)6/h14H,7-13H2,1-6H3 |
| InChIKey | UIBCKMWJXXLQOB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |