C40H26N4 — CID 153453070
12-[4-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-2-yl]-12-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,13,15,17,19-decaene (PubChem CID 153453070) has the molecular formula C40H26N4 and a molecular weight of 562.68 g/mol. Its IUPAC name is 12-[4-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-2-yl]-12-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,13,15,17,19-decaene.
| Compound Name | 12-[4-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-2-yl]-12-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,13,15,17,19-decaene |
|---|---|
| PubChem CID | 153453070 |
| Molecular Formula | C40H26N4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 12-[4-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-2-yl]-12-azapentacyclo[11.8.0.02,11.03,8.015,20]henicosa-1(21),2(11),3,5,7,9,13,15,17,19-decaene |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-n3c4cc5ccccc5cc4c4c5ccccc5ccc43)nc3c2C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C40H26N4/c1-40(2)32-15-9-8-14-30(32)38-36(40)37(25-16-19-28(41-3)20-17-25)42-39(43-38)44-33-21-18-24-10-6-7-13-29(24)35(33)31-22-26-11-4-5-12-27(26)23-34(31)44/h4-23H,1-2H3 |
| InChIKey | OAFVZONZCOGPMK-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|