C36H24N4 — CID 153453081
5-[2-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl]benzo[b]carbazole (PubChem CID 153453081) has the molecular formula C36H24N4 and a molecular weight of 512.62 g/mol. Its IUPAC name is 5-[2-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl]benzo[b]carbazole.
| Compound Name | 5-[2-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl]benzo[b]carbazole |
|---|---|
| PubChem CID | 153453081 |
| Molecular Formula | C36H24N4 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 5-[2-(4-isocyanophenyl)-5,5-dimethylindeno[1,2-d]pyrimidin-4-yl]benzo[b]carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2nc3c(c(-n4c5ccccc5c5cc6ccccc6cc54)n2)C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C36H24N4/c1-36(2)29-14-8-6-13-27(29)33-32(36)35(39-34(38-33)22-16-18-25(37-3)19-17-22)40-30-15-9-7-12-26(30)28-20-23-10-4-5-11-24(23)21-31(28)40/h4-21H,1-2H3 |
| InChIKey | MEMVKEJZWBBAOV-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|