C27H38N4O — CID 153453189
(8S)-N-[[(3R)-5-(2,2-dimethylmorpholin-4-yl)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 153453189) has the molecular formula C27H38N4O and a molecular weight of 434.63 g/mol. Its IUPAC name is (8S)-N-[[(3R)-5-(2,2-dimethylmorpholin-4-yl)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | (8S)-N-[[(3R)-5-(2,2-dimethylmorpholin-4-yl)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 153453189 |
| Molecular Formula | C27H38N4O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | (8S)-N-[[(3R)-5-(2,2-dimethylmorpholin-4-yl)-2-methyl-3,4-dihydro-1H-isoquinolin-3-yl]methyl]-N-methyl-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CN1Cc2cccc(N3CCOC(C)(C)C3)c2C[C@@H]1CN(C)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C27H38N4O/c1-27(2)19-31(14-15-32-27)24-11-6-9-21-17-29(3)22(16-23(21)24)18-30(4)25-12-5-8-20-10-7-13-28-26(20)25/h6-7,9-11,13,22,25H,5,8,12,14-19H2,1-4H3/t22-,25+/m1/s1 |
| InChIKey | XBWWAHKRMAPYDR-RDGATRHJSA-N |
| XLogP | 4.06 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |