C41H54N8O2Si — CID 153453960
N-(3-piperidin-1-ylpropyl)-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide (PubChem CID 153453960) has the molecular formula C41H54N8O2Si and a molecular weight of 719.02 g/mol. Its IUPAC name is N-(3-piperidin-1-ylpropyl)-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide.
| Compound Name | N-(3-piperidin-1-ylpropyl)-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 153453960 |
| Molecular Formula | C41H54N8O2Si |
| Molecular Weight | 719.02 g/mol |
| Exact Mass | 718.41 |
| IUPAC Name | N-(3-piperidin-1-ylpropyl)-5-[4-[4-(pyrrolidin-1-ylmethyl)anilino]-1,6-naphthyridin-2-yl]-1-(2-trimethylsilylethoxymethyl)benzimidazole-2-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1c(C(=O)NCCCN2CCCCC2)nc2cc(-c3cc(Nc4ccc(CN5CCCC5)cc4)c4cnccc4n3)ccc21 |
| InChI | InChI=1S/C41H54N8O2Si/c1-52(2,3)25-24-51-30-49-39-15-12-32(26-38(39)46-40(49)41(50)43-17-9-23-47-19-5-4-6-20-47)36-27-37(34-28-42-18-16-35(34)45-36)44-33-13-10-31(11-14-33)29-48-21-7-8-22-48/h10-16,18,26-28H,4-9,17,19-25,29-30H2,1-3H3,(H,43,50)(H,44,45) |
| InChIKey | WYSYKIILHPJSDJ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.02 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|