C62H76F2O9 — CID 153454756
[7-[1,7-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate (PubChem CID 153454756) has the molecular formula C62H76F2O9 and a molecular weight of 1003.28 g/mol. Its IUPAC name is [7-[1,7-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate.
| Compound Name | [7-[1,7-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153454756 |
| Molecular Formula | C62H76F2O9 |
| Molecular Weight | 1003.28 g/mol |
| Exact Mass | 1002.55 |
| IUPAC Name | [7-[1,7-bis[[3-(2-ethyl-4-pentylphenyl)-2-oxochromen-7-yl]oxy]heptan-4-yloxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(F)(F)CCCOC(CCCOc1ccc2cc(-c3ccc(CCCCC)cc3CC)c(=O)oc2c1)CCCOc1ccc2cc(-c3ccc(CCCCC)cc3CC)c(=O)oc2c1 |
| InChI | InChI=1S/C62H76F2O9/c1-7-11-13-19-44-23-29-53(46(9-3)37-44)55-39-48-25-27-51(41-57(48)72-60(55)66)69-33-15-21-50(68-35-17-31-62(63,64)32-18-36-71-59(65)43(5)6)22-16-34-70-52-28-26-49-40-56(61(67)73-58(49)42-52)54-30-24-45(20-14-12-8-2)38-47(54)10-4/h23-30,37-42,50H,5,7-22,31-36H2,1-4,6H3 |
| InChIKey | LYRNZALVKWNANO-UHFFFAOYSA-N |
| XLogP | 15.54 |
| TPSA | 114.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.28 |
| LogP ≤ 5 | 15.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|