C65H40IrN5O — CID 153458192
5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylbenzene-6-id-1-yl)pyridine;iridium(3+) (PubChem CID 153458192) has the molecular formula C65H40IrN5O and a molecular weight of 1099.29 g/mol. Its IUPAC name is 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylbenzene-6-id-1-yl)pyridine;iridium(3+).
| Compound Name | 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylbenzene-6-id-1-yl)pyridine;iridium(3+) |
|---|---|
| PubChem CID | 153458192 |
| Molecular Formula | C65H40IrN5O |
| Molecular Weight | 1099.29 g/mol |
| Exact Mass | 1099.29 |
| IUPAC Name | 5-[2-[3,5-bis[2-(1-phenylpyrazol-4-yl)phenyl]phenyl]phenyl]-2-(3-dibenzofuran-3-ylbenzene-6-id-1-yl)pyridine;iridium(3+) |
| SMILES | [Ir+3].[c-]1ccc(-c2ccc3c(c2)oc2ccccc23)cc1-c1ccc(-c2ccccc2-c2cc(-c3ccccc3-c3cnn(-c4[c-]cccc4)c3)cc(-c3ccccc3-c3cnn(-c4[c-]cccc4)c3)c2)cn1 |
| InChI | InChI=1S/C65H40N5O.Ir/c1-3-18-53(19-4-1)69-42-51(40-67-69)59-26-11-9-24-57(59)49-35-48(36-50(37-49)58-25-10-12-27-60(58)52-41-68-70(43-52)54-20-5-2-6-21-54)56-23-8-7-22-55(56)47-31-33-63(66-39-47)46-17-15-16-44(34-46)45-30-32-62-61-28-13-14-29-64(61)71-65(62)38-45;/h1-16,18,20,22-43H;/q-3;+3 |
| InChIKey | UUBOBCUIONRGJZ-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.29 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|