C37H25F3IrN2O-2 — CID 169301510
2-(4,7-dimethyl-2H-dibenzofuran-2-id-3-yl)-4-phenyl-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine (PubChem CID 169301510) has the molecular formula C37H25F3IrN2O-2 and a molecular weight of 762.83 g/mol. Its IUPAC name is 2-(4,7-dimethyl-2H-dibenzofuran-2-id-3-yl)-4-phenyl-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(4,7-dimethyl-2H-dibenzofuran-2-id-3-yl)-4-phenyl-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 169301510 |
| Molecular Formula | C37H25F3IrN2O-2 |
| Molecular Weight | 762.83 g/mol |
| Exact Mass | 763.16 |
| IUPAC Name | 2-(4,7-dimethyl-2H-dibenzofuran-2-id-3-yl)-4-phenyl-5-(trifluoromethyl)pyridine;iridium;2-phenylpyridine |
| SMILES | Cc1ccc2c(c1)oc1c(C)c(-c3cc(-c4ccccc4)c(C(F)(F)F)cn3)[c-]cc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H17F3NO.C11H8N.Ir/c1-15-8-9-19-20-11-10-18(16(2)25(20)31-24(19)12-15)23-13-21(17-6-4-3-5-7-17)22(14-30-23)26(27,28)29;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-9,11-14H,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | PVNOXBNLCVYJBY-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.83 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|