C34H40IrNO4- — CID 153460660
6-(3,5-dimethylbenzene-6-id-1-yl)oxy-2-phenylfuro[3,2-c]pyridine;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium (PubChem CID 153460660) has the molecular formula C34H40IrNO4- and a molecular weight of 718.91 g/mol. Its IUPAC name is 6-(3,5-dimethylbenzene-6-id-1-yl)oxy-2-phenylfuro[3,2-c]pyridine;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium.
| Compound Name | 6-(3,5-dimethylbenzene-6-id-1-yl)oxy-2-phenylfuro[3,2-c]pyridine;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 153460660 |
| Molecular Formula | C34H40IrNO4- |
| Molecular Weight | 718.91 g/mol |
| Exact Mass | 719.26 |
| IUPAC Name | 6-(3,5-dimethylbenzene-6-id-1-yl)oxy-2-phenylfuro[3,2-c]pyridine;(Z)-6-hydroxy-3,3,7,7-tetramethylnon-5-en-4-one;iridium |
| SMILES | CCC(C)(C)C(=O)/C=C(\O)C(C)(C)CC.Cc1[c-]c(Oc2cc3oc(-c4ccccc4)cc3cn2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C21H16NO2.C13H24O2.Ir/c1-14-8-15(2)10-18(9-14)23-21-12-20-17(13-22-21)11-19(24-20)16-6-4-3-5-7-16;1-7-12(3,4)10(14)9-11(15)13(5,6)8-2;/h3-9,11-13H,1-2H3;9,14H,7-8H2,1-6H3;/q-1;;/b;10-9-; |
| InChIKey | XRJPYXDPMKHDKW-MEILSSRFSA-N |
| XLogP | 9.57 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.91 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|