C20H36FeN3O4+3 — CID 153461661
(2S)-1-[4-[(2S)-2-hydroxypropyl]-7-[(4-methoxyphenyl)methyl]-1,4,7-triazonan-1-yl]propan-2-olate;iron(4+);hydrate (PubChem CID 153461661) has the molecular formula C20H36FeN3O4+3 and a molecular weight of 438.37 g/mol. Its IUPAC name is (2S)-1-[4-[(2S)-2-hydroxypropyl]-7-[(4-methoxyphenyl)methyl]-1,4,7-triazonan-1-yl]propan-2-olate;iron(4+);hydrate.
| Compound Name | (2S)-1-[4-[(2S)-2-hydroxypropyl]-7-[(4-methoxyphenyl)methyl]-1,4,7-triazonan-1-yl]propan-2-olate;iron(4+);hydrate |
|---|---|
| PubChem CID | 153461661 |
| Molecular Formula | C20H36FeN3O4+3 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (2S)-1-[4-[(2S)-2-hydroxypropyl]-7-[(4-methoxyphenyl)methyl]-1,4,7-triazonan-1-yl]propan-2-olate;iron(4+);hydrate |
| SMILES | COc1ccc(CN2CCN(C[C@H](C)[O-])CCN(C[C@H](C)O)CC2)cc1.O.[Fe+4] |
| InChI | InChI=1S/C20H34N3O3.Fe.H2O/c1-17(24)14-21-8-9-22(15-18(2)25)11-13-23(12-10-21)16-19-4-6-20(26-3)7-5-19;;/h4-7,17-18,24H,8-16H2,1-3H3;;1H2/q-1;+4;/t17-,18-;;/m0../s1 |
| InChIKey | KSBOJKDDQJEVLP-MPGISEFESA-N |
| XLogP | -0.58 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|