C54H24N6 — CID 153462043
2,5-bis(9-azahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-yl)-4,6-diisocyanobenzene-1,3-dicarbonitrile (PubChem CID 153462043) has the molecular formula C54H24N6 and a molecular weight of 756.83 g/mol. Its IUPAC name is 2,5-bis(9-azahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-yl)-4,6-diisocyanobenzene-1,3-dicarbonitrile.
| Compound Name | 2,5-bis(9-azahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-yl)-4,6-diisocyanobenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 153462043 |
| Molecular Formula | C54H24N6 |
| Molecular Weight | 756.83 g/mol |
| Exact Mass | 756.21 |
| IUPAC Name | 2,5-bis(9-azahexacyclo[10.10.1.02,10.03,8.013,18.019,23]tricosa-1(23),2(10),3,5,7,11,13,15,17,19,21-undecaen-9-yl)-4,6-diisocyanobenzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1c(C#N)c(-n2c3ccccc3c3c4cccc5c4c(cc32)-c2ccccc2-5)c(C#N)c([N+]#[C-])c1-n1c2ccccc2c2c3cccc4c3c(cc21)-c1ccccc1-4 |
| InChI | InChI=1S/C54H24N6/c1-57-51-41(27-55)53(59-43-23-9-7-17-35(43)49-37-21-11-19-33-29-13-3-5-15-31(29)39(47(33)37)25-45(49)59)42(28-56)52(58-2)54(51)60-44-24-10-8-18-36(44)50-38-22-12-20-34-30-14-4-6-16-32(30)40(48(34)38)26-46(50)60/h3-26H |
| InChIKey | VCLIMXOUDYAKHB-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.83 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|