C29H27F2N2O+ — CID 153464349
7-(cyclopentylmethyl)-4-(1,7-difluoro-2,3-dimethyldibenzofuran-4-yl)-3-methylquinazolin-3-ium (PubChem CID 153464349) has the molecular formula C29H27F2N2O+ and a molecular weight of 457.54 g/mol. Its IUPAC name is 7-(cyclopentylmethyl)-4-(1,7-difluoro-2,3-dimethyldibenzofuran-4-yl)-3-methylquinazolin-3-ium.
| Compound Name | 7-(cyclopentylmethyl)-4-(1,7-difluoro-2,3-dimethyldibenzofuran-4-yl)-3-methylquinazolin-3-ium |
|---|---|
| PubChem CID | 153464349 |
| Molecular Formula | C29H27F2N2O+ |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 7-(cyclopentylmethyl)-4-(1,7-difluoro-2,3-dimethyldibenzofuran-4-yl)-3-methylquinazolin-3-ium |
| SMILES | Cc1c(C)c(F)c2c(oc3cc(F)ccc32)c1-c1c2ccc(CC3CCCC3)cc2nc[n+]1C |
| InChI | InChI=1S/C29H27F2N2O/c1-16-17(2)27(31)26-22-11-9-20(30)14-24(22)34-29(26)25(16)28-21-10-8-19(12-18-6-4-5-7-18)13-23(21)32-15-33(28)3/h8-11,13-15,18H,4-7,12H2,1-3H3/q+1 |
| InChIKey | QNJDHCVQDDWZKS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|