C30H43FO5 — CID 153465189
[5-[[4-(4-decoxy-3-fluorophenyl)phenoxy]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]methanol (PubChem CID 153465189) has the molecular formula C30H43FO5 and a molecular weight of 502.67 g/mol. Its IUPAC name is [5-[[4-(4-decoxy-3-fluorophenyl)phenoxy]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]methanol.
| Compound Name | [5-[[4-(4-decoxy-3-fluorophenyl)phenoxy]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]methanol |
|---|---|
| PubChem CID | 153465189 |
| Molecular Formula | C30H43FO5 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | [5-[[4-(4-decoxy-3-fluorophenyl)phenoxy]methyl]-2,2-dimethyl-1,3-dioxan-5-yl]methanol |
| SMILES | CCCCCCCCCCOc1ccc(-c2ccc(OCC3(CO)COC(C)(C)OC3)cc2)cc1F |
| InChI | InChI=1S/C30H43FO5/c1-4-5-6-7-8-9-10-11-18-33-28-17-14-25(19-27(28)31)24-12-15-26(16-13-24)34-21-30(20-32)22-35-29(2,3)36-23-30/h12-17,19,32H,4-11,18,20-23H2,1-3H3 |
| InChIKey | LYSWFLSSNCFXHV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|