C13H7BrF6N2 — CID 153466466
5-[2,4-bis(trifluoromethyl)phenyl]-3-bromopyridin-2-amine (PubChem CID 153466466) has the molecular formula C13H7BrF6N2 and a molecular weight of 385.11 g/mol. Its IUPAC name is 5-[2,4-bis(trifluoromethyl)phenyl]-3-bromopyridin-2-amine.
| Compound Name | 5-[2,4-bis(trifluoromethyl)phenyl]-3-bromopyridin-2-amine |
|---|---|
| PubChem CID | 153466466 |
| Molecular Formula | C13H7BrF6N2 |
| Molecular Weight | 385.11 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | 5-[2,4-bis(trifluoromethyl)phenyl]-3-bromopyridin-2-amine |
| SMILES | Nc1ncc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H7BrF6N2/c14-10-3-6(5-22-11(10)21)8-2-1-7(12(15,16)17)4-9(8)13(18,19)20/h1-5H,(H2,21,22) |
| InChIKey | FCSYKMKDENSJMD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.11 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |