C38H45NO4 — CID 153466779
benzyl 3-[2-[3-[N,4-dimethyl-2,6-di(propan-2-yl)anilino]propoxy]-5-methylphenyl]-2-hydroxybenzoate (PubChem CID 153466779) has the molecular formula C38H45NO4 and a molecular weight of 579.78 g/mol. Its IUPAC name is benzyl 3-[2-[3-[N,4-dimethyl-2,6-di(propan-2-yl)anilino]propoxy]-5-methylphenyl]-2-hydroxybenzoate.
| Compound Name | benzyl 3-[2-[3-[N,4-dimethyl-2,6-di(propan-2-yl)anilino]propoxy]-5-methylphenyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 153466779 |
| Molecular Formula | C38H45NO4 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | benzyl 3-[2-[3-[N,4-dimethyl-2,6-di(propan-2-yl)anilino]propoxy]-5-methylphenyl]-2-hydroxybenzoate |
| SMILES | Cc1ccc(OCCCN(C)c2c(C(C)C)cc(C)cc2C(C)C)c(-c2cccc(C(=O)OCc3ccccc3)c2O)c1 |
| InChI | InChI=1S/C38H45NO4/c1-25(2)32-22-28(6)23-33(26(3)4)36(32)39(7)19-12-20-42-35-18-17-27(5)21-34(35)30-15-11-16-31(37(30)40)38(41)43-24-29-13-9-8-10-14-29/h8-11,13-18,21-23,25-26,40H,12,19-20,24H2,1-7H3 |
| InChIKey | XGPPEGBLHLCXAU-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|