C36H43NO2 — CID 153466682
2-[5-ethyl-2-[3-[N-methyl-2,6-di(propan-2-yl)anilino]propoxy]phenyl]-6-phenylphenol (PubChem CID 153466682) has the molecular formula C36H43NO2 and a molecular weight of 521.75 g/mol. Its IUPAC name is 2-[5-ethyl-2-[3-[N-methyl-2,6-di(propan-2-yl)anilino]propoxy]phenyl]-6-phenylphenol.
| Compound Name | 2-[5-ethyl-2-[3-[N-methyl-2,6-di(propan-2-yl)anilino]propoxy]phenyl]-6-phenylphenol |
|---|---|
| PubChem CID | 153466682 |
| Molecular Formula | C36H43NO2 |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | 2-[5-ethyl-2-[3-[N-methyl-2,6-di(propan-2-yl)anilino]propoxy]phenyl]-6-phenylphenol |
| SMILES | CCc1ccc(OCCCN(C)c2c(C(C)C)cccc2C(C)C)c(-c2cccc(-c3ccccc3)c2O)c1 |
| InChI | InChI=1S/C36H43NO2/c1-7-27-20-21-34(33(24-27)32-19-12-18-31(36(32)38)28-14-9-8-10-15-28)39-23-13-22-37(6)35-29(25(2)3)16-11-17-30(35)26(4)5/h8-12,14-21,24-26,38H,7,13,22-23H2,1-6H3 |
| InChIKey | WVCJQBLTHCAXAH-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|