C33H38BrHfN2O+ — CID 153466797
2-[2-(3-bromo-2-hydroxyphenyl)ethylamino]ethyl-(2-propan-2-ylphenyl)azanide;hafnium(4+);methanidylbenzene (PubChem CID 153466797) has the molecular formula C33H38BrHfN2O+ and a molecular weight of 737.07 g/mol. Its IUPAC name is 2-[2-(3-bromo-2-hydroxyphenyl)ethylamino]ethyl-(2-propan-2-ylphenyl)azanide;hafnium(4+);methanidylbenzene.
| Compound Name | 2-[2-(3-bromo-2-hydroxyphenyl)ethylamino]ethyl-(2-propan-2-ylphenyl)azanide;hafnium(4+);methanidylbenzene |
|---|---|
| PubChem CID | 153466797 |
| Molecular Formula | C33H38BrHfN2O+ |
| Molecular Weight | 737.07 g/mol |
| Exact Mass | 737.16 |
| IUPAC Name | 2-[2-(3-bromo-2-hydroxyphenyl)ethylamino]ethyl-(2-propan-2-ylphenyl)azanide;hafnium(4+);methanidylbenzene |
| SMILES | CC(C)c1ccccc1[N-]CCNCCc1cccc(Br)c1O.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[Hf+4] |
| InChI | InChI=1S/C19H24BrN2O.2C7H7.Hf/c1-14(2)16-7-3-4-9-18(16)22-13-12-21-11-10-15-6-5-8-17(20)19(15)23;2*1-7-5-3-2-4-6-7;/h3-9,14,21,23H,10-13H2,1-2H3;2*2-6H,1H2;/q3*-1;+4 |
| InChIKey | RXGNAJJWZPZIRS-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 46.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.07 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|