About 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol
2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol (PubChem CID 174772916) has the molecular formula C25H29NO
and a molecular weight of 359.51 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol.
Molecular Properties
| Compound Name | 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol |
| PubChem CID | 174772916 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol |
| SMILES | CC(C)c1cccc(C(C)C)c1NCc1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C25H29NO/c1-17(2)21-13-9-14-22(18(3)4)24(21)26-16-20-12-8-15-23(25(20)27)19-10-6-5-7-11-19/h5-15,17-18,26-27H,16H2,1-4H3 |
| InChIKey | HPEIKPOJGULFBF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol?
The IUPAC name of 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol (CID 174772916) is 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol.
What is the SMILES notation for 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol?
The canonical SMILES for 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol is CC(C)c1cccc(C(C)C)c1NCc1cccc(-c2ccccc2)c1O.
What is the InChIKey of 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol?
The InChIKey is HPEIKPOJGULFBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO/c1-17(2)21-13-9-14-22(18(3)4)24(21)26-16-20-12-8-15-23(25(20)27)19-10-6-5-7-11-19/h5-15,17-18,26-27H,16H2,1-4H3.
What are the key properties of 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol?
2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol has a molecular weight of 359.51 g/mol, XLogP of 6.92, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol is sourced from PubChem (CID 174772916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).