C25H29NO — CID 174772916
2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol (PubChem CID 174772916) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol.
| Compound Name | 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol |
|---|---|
| PubChem CID | 174772916 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)anilino]methyl]-6-phenylphenol |
| SMILES | CC(C)c1cccc(C(C)C)c1NCc1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C25H29NO/c1-17(2)21-13-9-14-22(18(3)4)24(21)26-16-20-12-8-15-23(25(20)27)19-10-6-5-7-11-19/h5-15,17-18,26-27H,16H2,1-4H3 |
| InChIKey | HPEIKPOJGULFBF-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|