C23H33NO — CID 174772917
2-tert-butyl-6-[[2,6-di(propan-2-yl)anilino]methyl]phenol (PubChem CID 174772917) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2,6-di(propan-2-yl)anilino]methyl]phenol.
| Compound Name | 2-tert-butyl-6-[[2,6-di(propan-2-yl)anilino]methyl]phenol |
|---|---|
| PubChem CID | 174772917 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 2-tert-butyl-6-[[2,6-di(propan-2-yl)anilino]methyl]phenol |
| SMILES | CC(C)c1cccc(C(C)C)c1NCc1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H33NO/c1-15(2)18-11-9-12-19(16(3)4)21(18)24-14-17-10-8-13-20(22(17)25)23(5,6)7/h8-13,15-16,24-25H,14H2,1-7H3 |
| InChIKey | IITXOEBPCYRYJD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|