C25H38N2O2 — CID 123908661
2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxyphenyl)methylamino]propylamino]methyl]phenol (PubChem CID 123908661) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxyphenyl)methylamino]propylamino]methyl]phenol.
| Compound Name | 2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxyphenyl)methylamino]propylamino]methyl]phenol |
|---|---|
| PubChem CID | 123908661 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 2-tert-butyl-6-[[2-[(3-tert-butyl-2-hydroxyphenyl)methylamino]propylamino]methyl]phenol |
| SMILES | CC(CNCc1cccc(C(C)(C)C)c1O)NCc1cccc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H38N2O2/c1-17(27-16-19-11-9-13-21(23(19)29)25(5,6)7)14-26-15-18-10-8-12-20(22(18)28)24(2,3)4/h8-13,17,26-29H,14-16H2,1-7H3 |
| InChIKey | HIEQXWZXGXOZKT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|