C25H29N — CID 153467800
5'-ethyl-1,1,3,3,8'-pentamethylspiro[cyclobutane-2,10'-indeno[1,2-b]indole] (PubChem CID 153467800) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is 5'-ethyl-1,1,3,3,8'-pentamethylspiro[cyclobutane-2,10'-indeno[1,2-b]indole].
| Compound Name | 5'-ethyl-1,1,3,3,8'-pentamethylspiro[cyclobutane-2,10'-indeno[1,2-b]indole] |
|---|---|
| PubChem CID | 153467800 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 5'-ethyl-1,1,3,3,8'-pentamethylspiro[cyclobutane-2,10'-indeno[1,2-b]indole] |
| SMILES | CCn1c2c(c3cc(C)ccc31)C1(c3ccccc3-2)C(C)(C)CC1(C)C |
| InChI | InChI=1S/C25H29N/c1-7-26-20-13-12-16(2)14-18(20)21-22(26)17-10-8-9-11-19(17)25(21)23(3,4)15-24(25,5)6/h8-14H,7,15H2,1-6H3 |
| InChIKey | BVMCWKFGKXJHJJ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |