C42H37N — CID 118312956
2-[10-(3,5-dimethylphenyl)anthracen-9-yl]-5-ethyl-8,10,10-trimethylindeno[1,2-b]indole (PubChem CID 118312956) has the molecular formula C42H37N and a molecular weight of 555.77 g/mol. Its IUPAC name is 2-[10-(3,5-dimethylphenyl)anthracen-9-yl]-5-ethyl-8,10,10-trimethylindeno[1,2-b]indole.
| Compound Name | 2-[10-(3,5-dimethylphenyl)anthracen-9-yl]-5-ethyl-8,10,10-trimethylindeno[1,2-b]indole |
|---|---|
| PubChem CID | 118312956 |
| Molecular Formula | C42H37N |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 2-[10-(3,5-dimethylphenyl)anthracen-9-yl]-5-ethyl-8,10,10-trimethylindeno[1,2-b]indole |
| SMILES | CCn1c2c(c3cc(C)ccc31)C(C)(C)c1cc(-c3c4ccccc4c(-c4cc(C)cc(C)c4)c4ccccc34)ccc1-2 |
| InChI | InChI=1S/C42H37N/c1-7-43-37-19-16-25(2)23-35(37)40-41(43)34-18-17-28(24-36(34)42(40,5)6)38-30-12-8-10-14-32(30)39(33-15-11-9-13-31(33)38)29-21-26(3)20-27(4)22-29/h8-24H,7H2,1-6H3 |
| InChIKey | RHWNWFXOULNXSO-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|