C27H32N8O5+2 — CID 153469655
N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl]-2-methyl-3-phenylbenzamide (PubChem CID 153469655) has the molecular formula C27H32N8O5+2 and a molecular weight of 548.60 g/mol. Its IUPAC name is N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl]-2-methyl-3-phenylbenzamide.
| Compound Name | N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl]-2-methyl-3-phenylbenzamide |
|---|---|
| PubChem CID | 153469655 |
| Molecular Formula | C27H32N8O5+2 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-1,3a,4,5,8,9-hexahydropyrrolo[1,2-c]purine-3,7-diium-9-yl]-2-methyl-3-phenylbenzamide |
| SMILES | Cc1c(C(=O)NC2C[N+]3=C(N)N[C@@H](CN4C(=O)CCC4=O)C4[NH+]=C(N)NC43C2(O)O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C27H30N8O5/c1-14-16(15-6-3-2-4-7-15)8-5-9-17(14)23(38)31-19-13-35-25(29)30-18(12-34-20(36)10-11-21(34)37)22-26(35,27(19,39)40)33-24(28)32-22/h2-9,18-19,22,39-40H,10-13H2,1H3,(H6,28,29,30,31,32,33,38)/p+2/t18-,19?,22?,26?/m0/s1 |
| InChIKey | BKUHOKMUIWXTSB-NYXLJVICSA-P |
| XLogP | -4.03 |
| TPSA | 200.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|