C27H31N8O5+ — CID 164845808
N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-methyl-3-phenylbenzamide (PubChem CID 164845808) has the molecular formula C27H31N8O5+ and a molecular weight of 547.60 g/mol. Its IUPAC name is N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-methyl-3-phenylbenzamide.
| Compound Name | N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-methyl-3-phenylbenzamide |
|---|---|
| PubChem CID | 164845808 |
| Molecular Formula | C27H31N8O5+ |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-methyl-3-phenylbenzamide |
| SMILES | Cc1c(C(=O)NC2CN3C(N)=N[C@@H](CN4C(=O)CCC4=O)[C@@H]4[NH+]=C(N)N[C@@]43C2(O)O)cccc1-c1ccccc1 |
| InChI | InChI=1S/C27H30N8O5/c1-14-16(15-6-3-2-4-7-15)8-5-9-17(14)23(38)31-19-13-35-25(29)30-18(12-34-20(36)10-11-21(34)37)22-26(35,27(19,39)40)33-24(28)32-22/h2-9,18-19,22,39-40H,10-13H2,1H3,(H2,29,30)(H,31,38)(H3,28,32,33)/p+1/t18-,19?,22-,26-/m0/s1 |
| InChIKey | KCGCOHMTNSAFBY-FLJMSRRESA-O |
| XLogP | -3.33 |
| TPSA | 200.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|