C25H35N8O5+ — CID 164845841
N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-tert-butyl-3-methylbenzamide (PubChem CID 164845841) has the molecular formula C25H35N8O5+ and a molecular weight of 527.61 g/mol. Its IUPAC name is N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-tert-butyl-3-methylbenzamide.
| Compound Name | N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-tert-butyl-3-methylbenzamide |
|---|---|
| PubChem CID | 164845841 |
| Molecular Formula | C25H35N8O5+ |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-[(3aS,4S)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-3-ium-9-yl]-2-tert-butyl-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC2CN3C(N)=N[C@@H](CN4C(=O)CCC4=O)C4[NH+]=C(N)NC43C2(O)O)c1C(C)(C)C |
| InChI | InChI=1S/C25H34N8O5/c1-12-6-5-7-13(18(12)23(2,3)4)20(36)29-15-11-33-22(27)28-14(10-32-16(34)8-9-17(32)35)19-24(33,25(15,37)38)31-21(26)30-19/h5-7,14-15,19,37-38H,8-11H2,1-4H3,(H2,27,28)(H,29,36)(H3,26,30,31)/p+1/t14-,15?,19?,24?/m0/s1 |
| InChIKey | QZYMXNUSERZMJU-DPMRGWTMSA-O |
| XLogP | -3.70 |
| TPSA | 200.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|