C23H30N8O5 — CID 164845893
N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2-ethyl-3-methylbenzamide (PubChem CID 164845893) has the molecular formula C23H30N8O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2-ethyl-3-methylbenzamide.
| Compound Name | N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2-ethyl-3-methylbenzamide |
|---|---|
| PubChem CID | 164845893 |
| Molecular Formula | C23H30N8O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[(3aS,4S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2-ethyl-3-methylbenzamide |
| SMILES | CCc1c(C)cccc1C(=O)NC1CN2C(N)=N[C@@H](CN3C(=O)CCC3=O)[C@@H]3N=C(N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C23H30N8O5/c1-3-12-11(2)5-4-6-13(12)19(34)27-15-10-31-21(25)26-14(9-30-16(32)7-8-17(30)33)18-22(31,23(15,35)36)29-20(24)28-18/h4-6,14-15,18,35-36H,3,7-10H2,1-2H3,(H2,25,26)(H,27,34)(H3,24,28,29)/t14-,15?,18-,22-/m0/s1 |
| InChIKey | DXAPHFAFUUOUBZ-JIFVMLOVSA-N |
| XLogP | -2.52 |
| TPSA | 198.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|