C20H22F2N8O5 — CID 130335075
N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,5-difluorobenzamide (PubChem CID 130335075) has the molecular formula C20H22F2N8O5 and a molecular weight of 492.44 g/mol. Its IUPAC name is N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,5-difluorobenzamide.
| Compound Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 130335075 |
| Molecular Formula | C20H22F2N8O5 |
| Molecular Weight | 492.44 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-2,5-difluorobenzamide |
| SMILES | NC1=N[C@H]2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](NC(=O)c4cc(F)ccc4F)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C20H22F2N8O5/c21-8-1-2-10(22)9(5-8)16(33)26-12-7-30-18(24)25-11(6-29-13(31)3-4-14(29)32)15-19(30,20(12,34)35)28-17(23)27-15/h1-2,5,11-12,15,34-35H,3-4,6-7H2,(H2,24,25)(H,26,33)(H3,23,27,28)/t11-,12-,15-,19-/m0/s1 |
| InChIKey | WCIXBIADERRDMY-UPDUFCCMSA-N |
| XLogP | -3.11 |
| TPSA | 198.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.44 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|