C21H23F3N8O6 — CID 130344309
N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 130344309) has the molecular formula C21H23F3N8O6 and a molecular weight of 540.46 g/mol. Its IUPAC name is N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 130344309 |
| Molecular Formula | C21H23F3N8O6 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | N-[2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | NC1=NC2C(CN3C(=O)CCC3=O)N=C(N)N3CC(NC(=O)c4ccc(OC(F)(F)F)cc4)C(O)(O)C23N1 |
| InChI | InChI=1S/C21H23F3N8O6/c22-21(23,24)38-10-3-1-9(2-4-10)16(35)28-12-8-32-18(26)27-11(7-31-13(33)5-6-14(31)34)15-19(32,20(12,36)37)30-17(25)29-15/h1-4,11-12,15,36-37H,5-8H2,(H2,26,27)(H,28,35)(H3,25,29,30) |
| InChIKey | ZSGMUTKXZBZVPK-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 208.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|