C19H24N8O6 — CID 130335162
N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-5-methylfuran-2-carboxamide (PubChem CID 130335162) has the molecular formula C19H24N8O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 130335162 |
| Molecular Formula | C19H24N8O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N[C@H]2CN3C(N)=N[C@@H](CN4C(=O)CCC4=O)[C@@H]4N=C(N)N[C@@]43C2(O)O)o1 |
| InChI | InChI=1S/C19H24N8O6/c1-8-2-3-10(33-8)15(30)23-11-7-27-17(21)22-9(6-26-12(28)4-5-13(26)29)14-18(27,19(11,31)32)25-16(20)24-14/h2-3,9,11,14,31-32H,4-7H2,1H3,(H2,21,22)(H,23,30)(H3,20,24,25)/t9-,11-,14-,18-/m0/s1 |
| InChIKey | AVMXSFLFPITSLE-YUXFNQDVSA-N |
| XLogP | -3.49 |
| TPSA | 212.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|