C15H22N8O5 — CID 130335139
N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]acetamide (PubChem CID 130335139) has the molecular formula C15H22N8O5 and a molecular weight of 394.39 g/mol. Its IUPAC name is N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]acetamide.
| Compound Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]acetamide |
|---|---|
| PubChem CID | 130335139 |
| Molecular Formula | C15H22N8O5 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[(3aS,4S,9S,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CN2C(N)=N[C@@H](CN3C(=O)CCC3=O)[C@@H]3N=C(N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C15H22N8O5/c1-6(24)18-8-5-23-13(17)19-7(4-22-9(25)2-3-10(22)26)11-14(23,15(8,27)28)21-12(16)20-11/h7-8,11,27-28H,2-5H2,1H3,(H2,17,19)(H,18,24)(H3,16,20,21)/t7-,8-,11-,14-/m0/s1 |
| InChIKey | LLVXVUDZJDQCAS-QYCJIWJESA-N |
| XLogP | -4.68 |
| TPSA | 198.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|