C13H19N7O5 — CID 130335027
1-[[(3aS,4S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 130335027) has the molecular formula C13H19N7O5 and a molecular weight of 353.34 g/mol. Its IUPAC name is 1-[[(3aS,4S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[(3aS,4S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130335027 |
| Molecular Formula | C13H19N7O5 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[[(3aS,4S,9S,10aS)-2,6-diamino-9,10,10-trihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | NC1=N[C@H]2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](O)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C13H19N7O5/c14-10-17-9-5(3-19-7(22)1-2-8(19)23)16-11(15)20-4-6(21)13(24,25)12(9,20)18-10/h5-6,9,21,24-25H,1-4H2,(H2,15,16)(H3,14,17,18)/t5-,6-,9-,12-/m0/s1 |
| InChIKey | XGQXGFBRKHJKRM-BRYRRJJASA-N |
| XLogP | -4.83 |
| TPSA | 190.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|