C13H19N7O4 — CID 166717343
1-[[(4S,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 166717343) has the molecular formula C13H19N7O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 1-[[(4S,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[(4S,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 166717343 |
| Molecular Formula | C13H19N7O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[[(4S,10aS)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | NC1=NC2[C@H](CN3C(=O)CCC3=O)N=C(N)N3CCC(O)(O)[C@]23N1 |
| InChI | InChI=1S/C13H19N7O4/c14-10-17-9-6(5-19-7(21)1-2-8(19)22)16-11(15)20-4-3-12(23,24)13(9,20)18-10/h6,9,23-24H,1-5H2,(H2,15,16)(H3,14,17,18)/t6-,9?,13-/m0/s1 |
| InChIKey | DXBQJUMPQKYUJH-TWHCGJEXSA-N |
| XLogP | -3.80 |
| TPSA | 169.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | -3.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|