C13H19N7O4 — CID 166717426
1-[[(4S,9S,10S)-2,6-diamino-9,10-dihydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 166717426) has the molecular formula C13H19N7O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 1-[[(4S,9S,10S)-2,6-diamino-9,10-dihydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[(4S,9S,10S)-2,6-diamino-9,10-dihydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 166717426 |
| Molecular Formula | C13H19N7O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[[(4S,9S,10S)-2,6-diamino-9,10-dihydroxy-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | NC1=NC2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](O)[C@@H](O)C23N1 |
| InChI | InChI=1S/C13H19N7O4/c14-11-17-9-5(3-19-7(22)1-2-8(19)23)16-12(15)20-4-6(21)10(24)13(9,20)18-11/h5-6,9-10,21,24H,1-4H2,(H2,15,16)(H3,14,17,18)/t5-,6-,9?,10+,13?/m0/s1 |
| InChIKey | PTAYWDIZMXKSCJ-IZXDOHTGSA-N |
| XLogP | -4.15 |
| TPSA | 169.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|