C14H21N7O7S — CID 130334937
[(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] methanesulfonate (PubChem CID 130334937) has the molecular formula C14H21N7O7S and a molecular weight of 431.43 g/mol. Its IUPAC name is [(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] methanesulfonate.
| Compound Name | [(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] methanesulfonate |
|---|---|
| PubChem CID | 130334937 |
| Molecular Formula | C14H21N7O7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [(3aS,10aS)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CN2C(N)=NC(CN3C(=O)CCC3=O)[C@@H]3N=C(N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C14H21N7O7S/c1-29(26,27)28-7-5-21-12(16)17-6(4-20-8(22)2-3-9(20)23)10-13(21,14(7,24)25)19-11(15)18-10/h6-7,10,24-25H,2-5H2,1H3,(H2,16,17)(H3,15,18,19)/t6?,7?,10-,13-/m0/s1 |
| InChIKey | USHCMEBBABOHJX-PUYOPAKASA-N |
| XLogP | -4.84 |
| TPSA | 213.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|