C20H24N8O6 — CID 130344124
[(4S,9S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate (PubChem CID 130344124) has the molecular formula C20H24N8O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is [(4S,9S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate.
| Compound Name | [(4S,9S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 130344124 |
| Molecular Formula | C20H24N8O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [(4S,9S,10aR)-2,6-diamino-4-[(2,5-dioxopyrrolidin-1-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate |
| SMILES | NC1=NC2[C@H](CN3C(=O)CCC3=O)N=C(N)N3C[C@H](OC(=O)Nc4ccccc4)C(O)(O)[C@@]23N1 |
| InChI | InChI=1S/C20H24N8O6/c21-16-25-15-11(8-27-13(29)6-7-14(27)30)24-17(22)28-9-12(20(32,33)19(15,28)26-16)34-18(31)23-10-4-2-1-3-5-10/h1-5,11-12,15,32-33H,6-9H2,(H2,22,24)(H,23,31)(H3,21,25,26)/t11-,12-,15?,19+/m0/s1 |
| InChIKey | GEILHOLDDQIPHB-ADEIVZBMSA-N |
| XLogP | -2.57 |
| TPSA | 208.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|