C16H21N7O5 — CID 118442448
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate (PubChem CID 118442448) has the molecular formula C16H21N7O5 and a molecular weight of 391.39 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 118442448 |
| Molecular Formula | C16H21N7O5 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] N-phenylcarbamate |
| SMILES | NC1=N[C@H]2[C@H](CO)N=C(N)N3C[C@H](OC(=O)Nc4ccccc4)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C16H21N7O5/c17-12-21-11-9(7-24)20-13(18)23-6-10(16(26,27)15(11,23)22-12)28-14(25)19-8-4-2-1-3-5-8/h1-5,9-11,24,26-27H,6-7H2,(H2,18,20)(H,19,25)(H3,17,21,22)/t9-,10-,11-,15-/m0/s1 |
| InChIKey | SIFQDJGLJJDLRT-VEABSNGSSA-N |
| XLogP | -2.73 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|