C16H18F2N6O5 — CID 126501414
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,3-difluorobenzoate (PubChem CID 126501414) has the molecular formula C16H18F2N6O5 and a molecular weight of 412.35 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,3-difluorobenzoate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,3-difluorobenzoate |
|---|---|
| PubChem CID | 126501414 |
| Molecular Formula | C16H18F2N6O5 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,3-difluorobenzoate |
| SMILES | NC1=N[C@H]2[C@H](CO)N=C(N)N3C[C@H](OC(=O)c4cccc(F)c4F)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C16H18F2N6O5/c17-7-3-1-2-6(10(7)18)12(26)29-9-4-24-14(20)21-8(5-25)11-15(24,16(9,27)28)23-13(19)22-11/h1-3,8-9,11,25,27-28H,4-5H2,(H2,20,21)(H3,19,22,23)/t8-,9-,11-,15-/m0/s1 |
| InChIKey | KFDULBARGPSZHI-HMDHDUFGSA-N |
| XLogP | -2.84 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|