C14H19F3N6O5 — CID 126539067
[(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 1-(trifluoromethyl)cyclopropane-1-carboxylate (PubChem CID 126539067) has the molecular formula C14H19F3N6O5 and a molecular weight of 408.34 g/mol. Its IUPAC name is [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 1-(trifluoromethyl)cyclopropane-1-carboxylate.
| Compound Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 1-(trifluoromethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 126539067 |
| Molecular Formula | C14H19F3N6O5 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [(3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 1-(trifluoromethyl)cyclopropane-1-carboxylate |
| SMILES | NC1=N[C@H]2[C@H](CO)N=C(N)N3C[C@H](OC(=O)C4(C(F)(F)F)CC4)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C14H19F3N6O5/c15-14(16,17)11(1-2-11)8(25)28-6-3-23-10(19)20-5(4-24)7-12(23,13(6,26)27)22-9(18)21-7/h5-7,24,26-27H,1-4H2,(H2,19,20)(H3,18,21,22)/t5-,6-,7-,12-/m0/s1 |
| InChIKey | XPBDZLSCLZEIPY-JCDSGLBZSA-N |
| XLogP | -3.09 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|